C11H13F3O2 — CID 117339948
1-[4-methoxy-3-(trifluoromethyl)phenyl]propan-2-ol (PubChem CID 117339948) has the molecular formula C11H13F3O2 and a molecular weight of 234.22 g/mol. Its IUPAC name is 1-[4-methoxy-3-(trifluoromethyl)phenyl]propan-2-ol.
| Compound Name | 1-[4-methoxy-3-(trifluoromethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 117339948 |
| Molecular Formula | C11H13F3O2 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 1-[4-methoxy-3-(trifluoromethyl)phenyl]propan-2-ol |
| SMILES | COc1ccc(CC(C)O)cc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3O2/c1-7(15)5-8-3-4-10(16-2)9(6-8)11(12,13)14/h3-4,6-7,15H,5H2,1-2H3 |
| InChIKey | LFNNQFAKZOGBNX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |