C12H16F3NO2 — CID 65364910
1-[4-(methoxymethoxy)-3-(trifluoromethyl)phenyl]propan-2-amine (PubChem CID 65364910) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 1-[4-(methoxymethoxy)-3-(trifluoromethyl)phenyl]propan-2-amine.
| Compound Name | 1-[4-(methoxymethoxy)-3-(trifluoromethyl)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 65364910 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 1-[4-(methoxymethoxy)-3-(trifluoromethyl)phenyl]propan-2-amine |
| SMILES | COCOc1ccc(CC(C)N)cc1C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO2/c1-8(16)5-9-3-4-11(18-7-17-2)10(6-9)12(13,14)15/h3-4,6,8H,5,7,16H2,1-2H3 |
| InChIKey | GOMAXPDMEIQBAK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|