C13H19ClF3NO — CID 170890489
1-[4-ethoxy-3-(trifluoromethyl)phenyl]butan-2-amine;hydrochloride (PubChem CID 170890489) has the molecular formula C13H19ClF3NO and a molecular weight of 297.75 g/mol. Its IUPAC name is 1-[4-ethoxy-3-(trifluoromethyl)phenyl]butan-2-amine;hydrochloride.
| Compound Name | 1-[4-ethoxy-3-(trifluoromethyl)phenyl]butan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 170890489 |
| Molecular Formula | C13H19ClF3NO |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[4-ethoxy-3-(trifluoromethyl)phenyl]butan-2-amine;hydrochloride |
| SMILES | CCOc1ccc(CC(N)CC)cc1C(F)(F)F.Cl |
| InChI | InChI=1S/C13H18F3NO.ClH/c1-3-10(17)7-9-5-6-12(18-4-2)11(8-9)13(14,15)16;/h5-6,8,10H,3-4,7,17H2,1-2H3;1H |
| InChIKey | YMYMOIYYCHOPFG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |