C14H19F4NO — CID 81114854
1-[4-(3-fluoropropoxy)-3-(trifluoromethyl)phenyl]butan-2-amine (PubChem CID 81114854) has the molecular formula C14H19F4NO and a molecular weight of 293.30 g/mol. Its IUPAC name is 1-[4-(3-fluoropropoxy)-3-(trifluoromethyl)phenyl]butan-2-amine.
| Compound Name | 1-[4-(3-fluoropropoxy)-3-(trifluoromethyl)phenyl]butan-2-amine |
|---|---|
| PubChem CID | 81114854 |
| Molecular Formula | C14H19F4NO |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[4-(3-fluoropropoxy)-3-(trifluoromethyl)phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1ccc(OCCCF)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F4NO/c1-2-11(19)8-10-4-5-13(20-7-3-6-15)12(9-10)14(16,17)18/h4-5,9,11H,2-3,6-8,19H2,1H3 |
| InChIKey | BWWDZQZQOPINOE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|