C15H20F3NO2 — CID 63319465
2-methoxy-N-[[4-(2-methylprop-2-enoxy)-3-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 63319465) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-methoxy-N-[[4-(2-methylprop-2-enoxy)-3-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[4-(2-methylprop-2-enoxy)-3-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 63319465 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-methoxy-N-[[4-(2-methylprop-2-enoxy)-3-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | C=C(C)COc1ccc(CNCCOC)cc1C(F)(F)F |
| InChI | InChI=1S/C15H20F3NO2/c1-11(2)10-21-14-5-4-12(9-19-6-7-20-3)8-13(14)15(16,17)18/h4-5,8,19H,1,6-7,9-10H2,2-3H3 |
| InChIKey | JKBVBIFFHTXKOA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|