C14H22FNO3 — CID 107689136
1-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenoxy]-2-methylpropan-2-ol (PubChem CID 107689136) has the molecular formula C14H22FNO3 and a molecular weight of 271.33 g/mol. Its IUPAC name is 1-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenoxy]-2-methylpropan-2-ol.
| Compound Name | 1-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenoxy]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 107689136 |
| Molecular Formula | C14H22FNO3 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenoxy]-2-methylpropan-2-ol |
| SMILES | COCCNCc1ccc(OCC(C)(C)O)c(F)c1 |
| InChI | InChI=1S/C14H22FNO3/c1-14(2,17)10-19-13-5-4-11(8-12(13)15)9-16-6-7-18-3/h4-5,8,16-17H,6-7,9-10H2,1-3H3 |
| InChIKey | RYTAGVANGOBSEW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|