C15H20FNO2 — CID 107689325
N-[(3-fluoro-4-pent-3-ynoxyphenyl)methyl]-2-methoxyethanamine (PubChem CID 107689325) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is N-[(3-fluoro-4-pent-3-ynoxyphenyl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(3-fluoro-4-pent-3-ynoxyphenyl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107689325 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-[(3-fluoro-4-pent-3-ynoxyphenyl)methyl]-2-methoxyethanamine |
| SMILES | CC#CCCOc1ccc(CNCCOC)cc1F |
| InChI | InChI=1S/C15H20FNO2/c1-3-4-5-9-19-15-7-6-13(11-14(15)16)12-17-8-10-18-2/h6-7,11,17H,5,8-10,12H2,1-2H3 |
| InChIKey | KNXKSFKGCDCPHX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|