C11H12Br2F3NO2 — CID 107741653
1-[3,5-dibromo-4-(2,2,2-trifluoroethoxymethoxy)phenyl]-N-methylmethanamine (PubChem CID 107741653) has the molecular formula C11H12Br2F3NO2 and a molecular weight of 407.02 g/mol. Its IUPAC name is 1-[3,5-dibromo-4-(2,2,2-trifluoroethoxymethoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3,5-dibromo-4-(2,2,2-trifluoroethoxymethoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107741653 |
| Molecular Formula | C11H12Br2F3NO2 |
| Molecular Weight | 407.02 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | 1-[3,5-dibromo-4-(2,2,2-trifluoroethoxymethoxy)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Br)c(OCOCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H12Br2F3NO2/c1-17-4-7-2-8(12)10(9(13)3-7)19-6-18-5-11(14,15)16/h2-3,17H,4-6H2,1H3 |
| InChIKey | VWCSFUKNLNQEMX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.02 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|