C10H13Br2NO2 — CID 107741642
1-[3,5-dibromo-4-(methoxymethoxy)phenyl]-N-methylmethanamine (PubChem CID 107741642) has the molecular formula C10H13Br2NO2 and a molecular weight of 339.03 g/mol. Its IUPAC name is 1-[3,5-dibromo-4-(methoxymethoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3,5-dibromo-4-(methoxymethoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 107741642 |
| Molecular Formula | C10H13Br2NO2 |
| Molecular Weight | 339.03 g/mol |
| Exact Mass | 336.93 |
| IUPAC Name | 1-[3,5-dibromo-4-(methoxymethoxy)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(Br)c(OCOC)c(Br)c1 |
| InChI | InChI=1S/C10H13Br2NO2/c1-13-5-7-3-8(11)10(9(12)4-7)15-6-14-2/h3-4,13H,5-6H2,1-2H3 |
| InChIKey | UROJHJTUOASRPU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.03 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|