C13H19Br2NO2 — CID 107743616
N-[[3,5-dibromo-4-(methoxymethoxy)phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 107743616) has the molecular formula C13H19Br2NO2 and a molecular weight of 381.11 g/mol. Its IUPAC name is N-[[3,5-dibromo-4-(methoxymethoxy)phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3,5-dibromo-4-(methoxymethoxy)phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107743616 |
| Molecular Formula | C13H19Br2NO2 |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 378.98 |
| IUPAC Name | N-[[3,5-dibromo-4-(methoxymethoxy)phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | COCOc1c(Br)cc(CNC(C)(C)C)cc1Br |
| InChI | InChI=1S/C13H19Br2NO2/c1-13(2,3)16-7-9-5-10(14)12(11(15)6-9)18-8-17-4/h5-6,16H,7-8H2,1-4H3 |
| InChIKey | UQDNBQVCLOCASS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|