C19H23BrClNO2 — CID 3546377
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-methylpropan-2-amine (PubChem CID 3546377) has the molecular formula C19H23BrClNO2 and a molecular weight of 412.76 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 3546377 |
| Molecular Formula | C19H23BrClNO2 |
| Molecular Weight | 412.76 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-methylpropan-2-amine |
| SMILES | COc1cc(CNC(C)(C)C)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23BrClNO2/c1-19(2,3)22-11-14-9-16(20)18(17(10-14)23-4)24-12-13-5-7-15(21)8-6-13/h5-10,22H,11-12H2,1-4H3 |
| InChIKey | CYQRWRYGCTUFPR-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.76 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |