C21H19BrClNO2 — CID 5093368
N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]aniline (PubChem CID 5093368) has the molecular formula C21H19BrClNO2 and a molecular weight of 432.75 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]aniline.
| Compound Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]aniline |
|---|---|
| PubChem CID | 5093368 |
| Molecular Formula | C21H19BrClNO2 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | N-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methyl]aniline |
| SMILES | COc1cc(CNc2ccccc2)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19BrClNO2/c1-25-20-12-16(13-24-18-5-3-2-4-6-18)11-19(22)21(20)26-14-15-7-9-17(23)10-8-15/h2-12,24H,13-14H2,1H3 |
| InChIKey | IBUHQSXXDUWKKF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |