C23H23BrFNO2 — CID 126124834
N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-ethylaniline (PubChem CID 126124834) has the molecular formula C23H23BrFNO2 and a molecular weight of 444.34 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-ethylaniline.
| Compound Name | N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-ethylaniline |
|---|---|
| PubChem CID | 126124834 |
| Molecular Formula | C23H23BrFNO2 |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-4-ethylaniline |
| SMILES | CCc1ccc(NCc2cc(Br)c(OCc3ccc(F)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H23BrFNO2/c1-3-16-6-10-20(11-7-16)26-14-18-12-21(24)23(22(13-18)27-2)28-15-17-4-8-19(25)9-5-17/h4-13,26H,3,14-15H2,1-2H3 |
| InChIKey | NWRHJIYQCVTURX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |