C23H24BrClFN3O4 — CID 17291607
N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 17291607) has the molecular formula C23H24BrClFN3O4 and a molecular weight of 540.82 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17291607 |
| Molecular Formula | C23H24BrClFN3O4 |
| Molecular Weight | 540.82 g/mol |
| Exact Mass | 539.06 |
| IUPAC Name | N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | COc1cc(CNCCNc2ccc([N+](=O)[O-])cc2)cc(Br)c1OCc1ccc(F)cc1.Cl |
| InChI | InChI=1S/C23H23BrFN3O4.ClH/c1-31-22-13-17(12-21(24)23(22)32-15-16-2-4-18(25)5-3-16)14-26-10-11-27-19-6-8-20(9-7-19)28(29)30;/h2-9,12-13,26-27H,10-11,14-15H2,1H3;1H |
| InChIKey | WCJNUVQQXXDBPJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.82 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|