C23H24BrClFNO2 — CID 17292601
N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine;hydrochloride (PubChem CID 17292601) has the molecular formula C23H24BrClFNO2 and a molecular weight of 480.81 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine;hydrochloride.
| Compound Name | N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17292601 |
| Molecular Formula | C23H24BrClFNO2 |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methyl]-2-(4-fluorophenyl)ethanamine;hydrochloride |
| SMILES | COc1cc(CNCCc2ccc(F)cc2)cc(Br)c1OCc1ccccc1.Cl |
| InChI | InChI=1S/C23H23BrFNO2.ClH/c1-27-22-14-19(15-26-12-11-17-7-9-20(25)10-8-17)13-21(24)23(22)28-16-18-5-3-2-4-6-18;/h2-10,13-14,26H,11-12,15-16H2,1H3;1H |
| InChIKey | SJVRSHSRILPRBV-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|