C18H20BrClFNO2 — CID 17291731
N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 17291731) has the molecular formula C18H20BrClFNO2 and a molecular weight of 416.72 g/mol. Its IUPAC name is N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291731 |
| Molecular Formula | C18H20BrClFNO2 |
| Molecular Weight | 416.72 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-[[3-bromo-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1cc(Br)c(OCc2ccc(F)cc2)c(OC)c1.Cl |
| InChI | InChI=1S/C18H19BrFNO2.ClH/c1-3-8-21-11-14-9-16(19)18(17(10-14)22-2)23-12-13-4-6-15(20)7-5-13;/h3-7,9-10,21H,1,8,11-12H2,2H3;1H |
| InChIKey | MZPVKLRIVDKWLF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.72 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|