C20H25BrClNO2 — CID 17055348
N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 17055348) has the molecular formula C20H25BrClNO2 and a molecular weight of 426.78 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17055348 |
| Molecular Formula | C20H25BrClNO2 |
| Molecular Weight | 426.78 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1cc(Br)c(OCc2ccc(C)cc2)c(OCC)c1.Cl |
| InChI | InChI=1S/C20H24BrNO2.ClH/c1-4-10-22-13-17-11-18(21)20(19(12-17)23-5-2)24-14-16-8-6-15(3)7-9-16;/h4,6-9,11-12,22H,1,5,10,13-14H2,2-3H3;1H |
| InChIKey | CREZHORCPMJZQA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.78 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|