C26H31BrClNO3 — CID 17055364
N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 17055364) has the molecular formula C26H31BrClNO3 and a molecular weight of 520.90 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17055364 |
| Molecular Formula | C26H31BrClNO3 |
| Molecular Weight | 520.90 g/mol |
| Exact Mass | 519.12 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCc2ccc(OC)cc2)cc(Br)c1OCc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C26H30BrNO3.ClH/c1-4-30-25-16-22(17-28-14-13-20-9-11-23(29-3)12-10-20)15-24(27)26(25)31-18-21-7-5-19(2)6-8-21;/h5-12,15-16,28H,4,13-14,17-18H2,1-3H3;1H |
| InChIKey | PRVBEZPFSPSSOU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.90 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|