C22H30BrNO2 — CID 17210645
N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine (PubChem CID 17210645) has the molecular formula C22H30BrNO2 and a molecular weight of 420.39 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 17210645 |
| Molecular Formula | C22H30BrNO2 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-3-methylbutan-1-amine |
| SMILES | CCOc1cc(CNCCC(C)C)cc(Br)c1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C22H30BrNO2/c1-5-25-21-13-19(14-24-11-10-16(2)3)12-20(23)22(21)26-15-18-8-6-17(4)7-9-18/h6-9,12-13,16,24H,5,10-11,14-15H2,1-4H3 |
| InChIKey | BKODKWNTPJDKAP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|