C25H27BrCl3NO2 — CID 17209884
N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride (PubChem CID 17209884) has the molecular formula C25H27BrCl3NO2 and a molecular weight of 559.76 g/mol. Its IUPAC name is N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride.
| Compound Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17209884 |
| Molecular Formula | C25H27BrCl3NO2 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 557.03 |
| IUPAC Name | N-[[3-bromo-5-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methyl]-2-(2,4-dichlorophenyl)ethanamine;hydrochloride |
| SMILES | CCOc1cc(CNCCc2ccc(Cl)cc2Cl)cc(Br)c1OCc1ccc(C)cc1.Cl |
| InChI | InChI=1S/C25H26BrCl2NO2.ClH/c1-3-30-24-13-19(15-29-11-10-20-8-9-21(27)14-23(20)28)12-22(26)25(24)31-16-18-6-4-17(2)5-7-18;/h4-9,12-14,29H,3,10-11,15-16H2,1-2H3;1H |
| InChIKey | IDIGQPPCUALSHP-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|