C20H25BrCl2N2O3 — CID 4720644
2-[2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethylamino]ethanol (PubChem CID 4720644) has the molecular formula C20H25BrCl2N2O3 and a molecular weight of 492.24 g/mol. Its IUPAC name is 2-[2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethylamino]ethanol.
| Compound Name | 2-[2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethylamino]ethanol |
|---|---|
| PubChem CID | 4720644 |
| Molecular Formula | C20H25BrCl2N2O3 |
| Molecular Weight | 492.24 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 2-[2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethylamino]ethanol |
| SMILES | CCOc1cc(CNCCNCCO)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H25BrCl2N2O3/c1-2-27-19-10-14(12-25-6-5-24-7-8-26)9-17(21)20(19)28-13-15-3-4-16(22)11-18(15)23/h3-4,9-11,24-26H,2,5-8,12-13H2,1H3 |
| InChIKey | JKOYWIHJFOJZNN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.24 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|