C18H20BrCl2NO3 — CID 2200479
2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethanol (PubChem CID 2200479) has the molecular formula C18H20BrCl2NO3 and a molecular weight of 449.17 g/mol. Its IUPAC name is 2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethanol.
| Compound Name | 2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 2200479 |
| Molecular Formula | C18H20BrCl2NO3 |
| Molecular Weight | 449.17 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | 2-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]ethanol |
| SMILES | CCOc1cc(CNCCO)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H20BrCl2NO3/c1-2-24-17-8-12(10-22-5-6-23)7-15(19)18(17)25-11-13-3-4-14(20)9-16(13)21/h3-4,7-9,22-23H,2,5-6,10-11H2,1H3 |
| InChIKey | LSEBIOJOUZJDNG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.17 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|