C22H29BrCl3NO2 — CID 17291105
N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]hexan-1-amine;hydrochloride (PubChem CID 17291105) has the molecular formula C22H29BrCl3NO2 and a molecular weight of 525.74 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]hexan-1-amine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291105 |
| Molecular Formula | C22H29BrCl3NO2 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methyl]hexan-1-amine;hydrochloride |
| SMILES | CCCCCCNCc1cc(Br)c(OCc2ccc(Cl)cc2Cl)c(OCC)c1.Cl |
| InChI | InChI=1S/C22H28BrCl2NO2.ClH/c1-3-5-6-7-10-26-14-16-11-19(23)22(21(12-16)27-4-2)28-15-17-8-9-18(24)13-20(17)25;/h8-9,11-13,26H,3-7,10,14-15H2,1-2H3;1H |
| InChIKey | DAANREFYPSCFSU-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|