C20H26BrCl2NO2 — CID 17289443
N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]butan-1-amine;hydrochloride (PubChem CID 17289443) has the molecular formula C20H26BrCl2NO2 and a molecular weight of 463.24 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]butan-1-amine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17289443 |
| Molecular Formula | C20H26BrCl2NO2 |
| Molecular Weight | 463.24 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCc1cc(Br)c(OCc2ccccc2Cl)c(OCC)c1.Cl |
| InChI | InChI=1S/C20H25BrClNO2.ClH/c1-3-5-10-23-13-15-11-17(21)20(19(12-15)24-4-2)25-14-16-8-6-7-9-18(16)22;/h6-9,11-12,23H,3-5,10,13-14H2,1-2H3;1H |
| InChIKey | SFTCXLIFDQJNDL-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.24 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|