C24H25BrClNO3 — CID 4720604
2-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-1-phenylethanol (PubChem CID 4720604) has the molecular formula C24H25BrClNO3 and a molecular weight of 490.83 g/mol. Its IUPAC name is 2-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-1-phenylethanol.
| Compound Name | 2-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 4720604 |
| Molecular Formula | C24H25BrClNO3 |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | 2-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylamino]-1-phenylethanol |
| SMILES | CCOc1cc(CNCC(O)c2ccccc2)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H25BrClNO3/c1-2-29-23-13-17(14-27-15-22(28)18-8-4-3-5-9-18)12-20(25)24(23)30-16-19-10-6-7-11-21(19)26/h3-13,22,27-28H,2,14-16H2,1H3 |
| InChIKey | PWQICZNNSWPNRC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |