C20H26ClNO3 — CID 51987234
(1S)-2-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]-1-phenylethanol (PubChem CID 51987234) has the molecular formula C20H26ClNO3 and a molecular weight of 363.89 g/mol. Its IUPAC name is (1S)-2-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]-1-phenylethanol.
| Compound Name | (1S)-2-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 51987234 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | (1S)-2-[(3-chloro-5-ethoxy-4-propan-2-yloxyphenyl)methylamino]-1-phenylethanol |
| SMILES | CCOc1cc(CNC[C@@H](O)c2ccccc2)cc(Cl)c1OC(C)C |
| InChI | InChI=1S/C20H26ClNO3/c1-4-24-19-11-15(10-17(21)20(19)25-14(2)3)12-22-13-18(23)16-8-6-5-7-9-16/h5-11,14,18,22-23H,4,12-13H2,1-3H3/t18-/m1/s1 |
| InChIKey | PMMNAWYKXUHDRT-GOSISDBHSA-N |
| XLogP | 4.35 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |