C19H21BrClNO2 — CID 4717931
N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]prop-2-en-1-amine (PubChem CID 4717931) has the molecular formula C19H21BrClNO2 and a molecular weight of 410.74 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]prop-2-en-1-amine.
| Compound Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 4717931 |
| Molecular Formula | C19H21BrClNO2 |
| Molecular Weight | 410.74 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | N-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methyl]prop-2-en-1-amine |
| SMILES | C=CCNCc1cc(Br)c(OCc2ccccc2Cl)c(OCC)c1 |
| InChI | InChI=1S/C19H21BrClNO2/c1-3-9-22-12-14-10-16(20)19(18(11-14)23-4-2)24-13-15-7-5-6-8-17(15)21/h3,5-8,10-11,22H,1,4,9,12-13H2,2H3 |
| InChIKey | UJEKIUBSWRMWJP-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.74 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|