C13H19BrClNO2 — CID 17291767
N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride (PubChem CID 17291767) has the molecular formula C13H19BrClNO2 and a molecular weight of 336.66 g/mol. Its IUPAC name is N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride.
| Compound Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291767 |
| Molecular Formula | C13H19BrClNO2 |
| Molecular Weight | 336.66 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | N-[(3-bromo-4-ethoxy-5-methoxyphenyl)methyl]prop-2-en-1-amine;hydrochloride |
| SMILES | C=CCNCc1cc(Br)c(OCC)c(OC)c1.Cl |
| InChI | InChI=1S/C13H18BrNO2.ClH/c1-4-6-15-9-10-7-11(14)13(17-5-2)12(8-10)16-3;/h4,7-8,15H,1,5-6,9H2,2-3H3;1H |
| InChIKey | FTRMLKQSMXXHKV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|