C17H27BrClNO2 — CID 17291143
N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]hexan-1-amine;hydrochloride (PubChem CID 17291143) has the molecular formula C17H27BrClNO2 and a molecular weight of 392.77 g/mol. Its IUPAC name is N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]hexan-1-amine;hydrochloride.
| Compound Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]hexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291143 |
| Molecular Formula | C17H27BrClNO2 |
| Molecular Weight | 392.77 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methyl]hexan-1-amine;hydrochloride |
| SMILES | C=CCOc1c(Br)cc(CNCCCCCC)cc1OC.Cl |
| InChI | InChI=1S/C17H26BrNO2.ClH/c1-4-6-7-8-9-19-13-14-11-15(18)17(21-10-5-2)16(12-14)20-3;/h5,11-12,19H,2,4,6-10,13H2,1,3H3;1H |
| InChIKey | RFGRRNQBAHSTML-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|