C22H30BrClFNO2 — CID 17291218
N-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine;hydrochloride (PubChem CID 17291218) has the molecular formula C22H30BrClFNO2 and a molecular weight of 474.84 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291218 |
| Molecular Formula | C22H30BrClFNO2 |
| Molecular Weight | 474.84 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-[[3-bromo-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]heptan-1-amine;hydrochloride |
| SMILES | CCCCCCCNCc1cc(Br)c(OCc2ccccc2F)c(OC)c1.Cl |
| InChI | InChI=1S/C22H29BrFNO2.ClH/c1-3-4-5-6-9-12-25-15-17-13-19(23)22(21(14-17)26-2)27-16-18-10-7-8-11-20(18)24;/h7-8,10-11,13-14,25H,3-6,9,12,15-16H2,1-2H3;1H |
| InChIKey | XCTSDQFEUKKSEO-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.84 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|