C19H23BrCl3NO2 — CID 155971329
N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]butan-1-amine;hydrochloride (PubChem CID 155971329) has the molecular formula C19H23BrCl3NO2 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]butan-1-amine;hydrochloride.
| Compound Name | N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 155971329 |
| Molecular Formula | C19H23BrCl3NO2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | N-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCc1cc(Br)c(OCc2ccc(Cl)cc2Cl)c(OC)c1.Cl |
| InChI | InChI=1S/C19H22BrCl2NO2.ClH/c1-3-4-7-23-11-13-8-16(20)19(18(9-13)24-2)25-12-14-5-6-15(21)10-17(14)22;/h5-6,8-10,23H,3-4,7,11-12H2,1-2H3;1H |
| InChIKey | IDKKXJCYQUGNFA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|