C22H25BrCl2N2O3 — CID 17211926
1-[3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one (PubChem CID 17211926) has the molecular formula C22H25BrCl2N2O3 and a molecular weight of 516.26 g/mol. Its IUPAC name is 1-[3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 17211926 |
| Molecular Formula | C22H25BrCl2N2O3 |
| Molecular Weight | 516.26 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | 1-[3-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylamino]propyl]pyrrolidin-2-one |
| SMILES | COc1cc(CNCCCN2CCCC2=O)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H25BrCl2N2O3/c1-29-20-11-15(13-26-7-3-9-27-8-2-4-21(27)28)10-18(23)22(20)30-14-16-5-6-17(24)12-19(16)25/h5-6,10-12,26H,2-4,7-9,13-14H2,1H3 |
| InChIKey | LWBPVTSLBUUUIM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.26 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|