C14H19Cl3N2O — CID 17211943
1-[3-[(2,4-dichlorophenyl)methylamino]propyl]pyrrolidin-2-one;hydrochloride (PubChem CID 17211943) has the molecular formula C14H19Cl3N2O and a molecular weight of 337.68 g/mol. Its IUPAC name is 1-[3-[(2,4-dichlorophenyl)methylamino]propyl]pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-[3-[(2,4-dichlorophenyl)methylamino]propyl]pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 17211943 |
| Molecular Formula | C14H19Cl3N2O |
| Molecular Weight | 337.68 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 1-[3-[(2,4-dichlorophenyl)methylamino]propyl]pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1CCCN1CCCNCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O.ClH/c15-12-5-4-11(13(16)9-12)10-17-6-2-8-18-7-1-3-14(18)19;/h4-5,9,17H,1-3,6-8,10H2;1H |
| InChIKey | UPCWBWDORLLLEQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.68 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|