C18H23ClN2O — CID 17211895
1-[3-(naphthalen-1-ylmethylamino)propyl]pyrrolidin-2-one;hydrochloride (PubChem CID 17211895) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is 1-[3-(naphthalen-1-ylmethylamino)propyl]pyrrolidin-2-one;hydrochloride.
| Compound Name | 1-[3-(naphthalen-1-ylmethylamino)propyl]pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 17211895 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[3-(naphthalen-1-ylmethylamino)propyl]pyrrolidin-2-one;hydrochloride |
| SMILES | Cl.O=C1CCCN1CCCNCc1cccc2ccccc12 |
| InChI | InChI=1S/C18H22N2O.ClH/c21-18-10-4-12-20(18)13-5-11-19-14-16-8-3-7-15-6-1-2-9-17(15)16;/h1-3,6-9,19H,4-5,10-14H2;1H |
| InChIKey | AMPFYUOCNJJCEJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|