C16H20Cl2N4O — CID 75419432
2-[3-[(2,4-dichlorophenyl)methylamino]propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 75419432) has the molecular formula C16H20Cl2N4O and a molecular weight of 355.27 g/mol. Its IUPAC name is 2-[3-[(2,4-dichlorophenyl)methylamino]propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[3-[(2,4-dichlorophenyl)methylamino]propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 75419432 |
| Molecular Formula | C16H20Cl2N4O |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[3-[(2,4-dichlorophenyl)methylamino]propyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=c1n(CCCNCc2ccc(Cl)cc2Cl)nc2n1CCCC2 |
| InChI | InChI=1S/C16H20Cl2N4O/c17-13-6-5-12(14(18)10-13)11-19-7-3-9-22-16(23)21-8-2-1-4-15(21)20-22/h5-6,10,19H,1-4,7-9,11H2 |
| InChIKey | CATOIBNTACVOJX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|