C17H21Cl2N5O2 — CID 55769881
1-[(2,4-dichlorophenyl)methyl]-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea (PubChem CID 55769881) has the molecular formula C17H21Cl2N5O2 and a molecular weight of 398.29 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
|---|---|
| PubChem CID | 55769881 |
| Molecular Formula | C17H21Cl2N5O2 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-3-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]urea |
| SMILES | O=C(NCCCn1nc2n(c1=O)CCCC2)NCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H21Cl2N5O2/c18-13-6-5-12(14(19)10-13)11-21-16(25)20-7-3-9-24-17(26)23-8-2-1-4-15(23)22-24/h5-6,10H,1-4,7-9,11H2,(H2,20,21,25) |
| InChIKey | SSRMPECNTIRHDW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|