C22H31N5O4S — CID 55766803
N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide (PubChem CID 55766803) has the molecular formula C22H31N5O4S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 55766803 |
| Molecular Formula | C22H31N5O4S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2c(c1)CCCC2)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C22H31N5O4S/c28-21(23-12-5-15-27-22(29)26-14-4-3-8-20(26)25-27)11-13-24-32(30,31)19-10-9-17-6-1-2-7-18(17)16-19/h9-10,16,24H,1-8,11-15H2,(H,23,28) |
| InChIKey | CPNKDFIHWQBOIL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|