C21H29N5O6S — CID 55859740
3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]propanamide (PubChem CID 55859740) has the molecular formula C21H29N5O6S and a molecular weight of 479.56 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]propanamide.
| Compound Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]propanamide |
|---|---|
| PubChem CID | 55859740 |
| Molecular Formula | C21H29N5O6S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 3-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2c(c1)OCCCO2)NCCCn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C21H29N5O6S/c27-20(22-9-3-12-26-21(28)25-11-2-1-5-19(25)24-26)8-10-23-33(29,30)16-6-7-17-18(15-16)32-14-4-13-31-17/h6-7,15,23H,1-5,8-14H2,(H,22,27) |
| InChIKey | CSZJUQHCEVMRAT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|