C19H20ClN5O2S — CID 55766492
2-(4-chlorophenyl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,3-thiazole-4-carboxamide (PubChem CID 55766492) has the molecular formula C19H20ClN5O2S and a molecular weight of 417.92 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55766492 |
| Molecular Formula | C19H20ClN5O2S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCn1nc2n(c1=O)CCCC2)c1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H20ClN5O2S/c20-14-7-5-13(6-8-14)18-22-15(12-28-18)17(26)21-9-3-11-25-19(27)24-10-2-1-4-16(24)23-25/h5-8,12H,1-4,9-11H2,(H,21,26) |
| InChIKey | VWLZBSVUABCZSE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|