C17H21ClN4OS — CID 119393747
2-(4-chlorophenyl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 119393747) has the molecular formula C17H21ClN4OS and a molecular weight of 364.90 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 119393747 |
| Molecular Formula | C17H21ClN4OS |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCN1CCNCC1)c1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C17H21ClN4OS/c18-14-4-2-13(3-5-14)17-21-15(12-24-17)16(23)20-6-1-9-22-10-7-19-8-11-22/h2-5,12,19H,1,6-11H2,(H,20,23) |
| InChIKey | QUBXKCFAAGJENQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|