C15H22Cl2N4O2S — CID 119394566
2-(furan-3-yl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide;dihydrochloride (PubChem CID 119394566) has the molecular formula C15H22Cl2N4O2S and a molecular weight of 393.34 g/mol. Its IUPAC name is 2-(furan-3-yl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide;dihydrochloride.
| Compound Name | 2-(furan-3-yl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119394566 |
| Molecular Formula | C15H22Cl2N4O2S |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 2-(furan-3-yl)-N-(3-piperazin-1-ylpropyl)-1,3-thiazole-4-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCN1CCNCC1)c1csc(-c2ccoc2)n1 |
| InChI | InChI=1S/C15H20N4O2S.2ClH/c20-14(17-3-1-6-19-7-4-16-5-8-19)13-11-22-15(18-13)12-2-9-21-10-12;;/h2,9-11,16H,1,3-8H2,(H,17,20);2*1H |
| InChIKey | JRXJDCYYOFNYOD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|