C17H23N3O3S — CID 111435984
2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-N-[3-(4-hydroxypiperidin-1-yl)propyl]acetamide (PubChem CID 111435984) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-N-[3-(4-hydroxypiperidin-1-yl)propyl]acetamide.
| Compound Name | 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-N-[3-(4-hydroxypiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 111435984 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-[2-(furan-3-yl)-1,3-thiazol-4-yl]-N-[3-(4-hydroxypiperidin-1-yl)propyl]acetamide |
| SMILES | O=C(Cc1csc(-c2ccoc2)n1)NCCCN1CCC(O)CC1 |
| InChI | InChI=1S/C17H23N3O3S/c21-15-2-7-20(8-3-15)6-1-5-18-16(22)10-14-12-24-17(19-14)13-4-9-23-11-13/h4,9,11-12,15,21H,1-3,5-8,10H2,(H,18,22) |
| InChIKey | NGZJVNKPOJFMEA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|