C16H16N4O2S — CID 146149820
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[2-(furan-3-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 146149820) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[2-(furan-3-yl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[2-(furan-3-yl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 146149820 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[2-(furan-3-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | C#CCCC1(CCNC(=O)Cc2csc(-c3ccoc3)n2)N=N1 |
| InChI | InChI=1S/C16H16N4O2S/c1-2-3-5-16(19-20-16)6-7-17-14(21)9-13-11-23-15(18-13)12-4-8-22-10-12/h1,4,8,10-11H,3,5-7,9H2,(H,17,21) |
| InChIKey | BWBRTJSLYRUMBM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|