C18H25N5OS — CID 166416726
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[2-[(1-methylcyclopentyl)amino]-1,3-thiazol-4-yl]acetamide (PubChem CID 166416726) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[2-[(1-methylcyclopentyl)amino]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[2-[(1-methylcyclopentyl)amino]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 166416726 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[2-[(1-methylcyclopentyl)amino]-1,3-thiazol-4-yl]acetamide |
| SMILES | C#CCCC1(CCNC(=O)Cc2csc(NC3(C)CCCC3)n2)N=N1 |
| InChI | InChI=1S/C18H25N5OS/c1-3-4-9-18(22-23-18)10-11-19-15(24)12-14-13-25-16(20-14)21-17(2)7-5-6-8-17/h1,13H,4-12H2,2H3,(H,19,24)(H,20,21) |
| InChIKey | FCDIQYUXPJHFHO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|