C15H18N4O3S — CID 166417899
methyl 3-[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1,3-thiazol-4-yl]propanoate (PubChem CID 166417899) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is methyl 3-[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1,3-thiazol-4-yl]propanoate.
| Compound Name | methyl 3-[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 166417899 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl 3-[2-[3-(3-but-3-ynyldiazirin-3-yl)propanoylamino]-1,3-thiazol-4-yl]propanoate |
| SMILES | C#CCCC1(CCC(=O)Nc2nc(CCC(=O)OC)cs2)N=N1 |
| InChI | InChI=1S/C15H18N4O3S/c1-3-4-8-15(18-19-15)9-7-12(20)17-14-16-11(10-23-14)5-6-13(21)22-2/h1,10H,4-9H2,2H3,(H,16,17,20) |
| InChIKey | ORDLBSPFKBWDFY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|