C12H17N3O5S — CID 122087221
4-[[4-(3-methoxy-3-oxopropyl)-1,3-thiazol-2-yl]carbamoylamino]butanoic acid (PubChem CID 122087221) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-[[4-(3-methoxy-3-oxopropyl)-1,3-thiazol-2-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[4-(3-methoxy-3-oxopropyl)-1,3-thiazol-2-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122087221 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-[[4-(3-methoxy-3-oxopropyl)-1,3-thiazol-2-yl]carbamoylamino]butanoic acid |
| SMILES | COC(=O)CCc1csc(NC(=O)NCCCC(=O)O)n1 |
| InChI | InChI=1S/C12H17N3O5S/c1-20-10(18)5-4-8-7-21-12(14-8)15-11(19)13-6-2-3-9(16)17/h7H,2-6H2,1H3,(H,16,17)(H2,13,14,15,19) |
| InChIKey | QMHHSNPMFTUYJQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|