C12H18N2O4S — CID 80655638
4-[2-(4-methoxybutanoylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80655638) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-[2-(4-methoxybutanoylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(4-methoxybutanoylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80655638 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-[2-(4-methoxybutanoylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | COCCCC(=O)Nc1nc(CCCC(=O)O)cs1 |
| InChI | InChI=1S/C12H18N2O4S/c1-18-7-3-5-10(15)14-12-13-9(8-19-12)4-2-6-11(16)17/h8H,2-7H2,1H3,(H,16,17)(H,13,14,15) |
| InChIKey | PDHISKAMVRMLAX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|