C10H10N4O3S2 — CID 80655852
4-[2-(thiadiazole-5-carbonylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80655852) has the molecular formula C10H10N4O3S2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-[2-(thiadiazole-5-carbonylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(thiadiazole-5-carbonylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80655852 |
| Molecular Formula | C10H10N4O3S2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 4-[2-(thiadiazole-5-carbonylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(NC(=O)c2cnns2)n1 |
| InChI | InChI=1S/C10H10N4O3S2/c15-8(16)3-1-2-6-5-18-10(12-6)13-9(17)7-4-11-14-19-7/h4-5H,1-3H2,(H,15,16)(H,12,13,17) |
| InChIKey | NMMRJKNAOALGIH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |