C12H12N2O3S2 — CID 80656589
4-[2-(thiophene-3-carbonylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80656589) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 4-[2-(thiophene-3-carbonylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(thiophene-3-carbonylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80656589 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 4-[2-(thiophene-3-carbonylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(NC(=O)c2ccsc2)n1 |
| InChI | InChI=1S/C12H12N2O3S2/c15-10(16)3-1-2-9-7-19-12(13-9)14-11(17)8-4-5-18-6-8/h4-7H,1-3H2,(H,15,16)(H,13,14,17) |
| InChIKey | LJDKHIPVZUSZKH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |