C15H17N3O3S — CID 18322950
4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 18322950) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 18322950 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(NC(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C15H17N3O3S/c19-13(20)8-4-7-12-10-22-15(17-12)18-14(21)16-9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,19,20)(H2,16,17,18,21) |
| InChIKey | XBWFDZIDSWAQCE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |