4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid

C15H17N3O3S — CID 18322950

IUPAC4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid
SMILESO=C(O)CCCc1csc(NC(=O)NCc2ccccc2)n1
InChIInChI=1S/C15H17N3O3S/c19-13(20)8-4-7-12-10-22-15(17-12)18-14(21)16-9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,19,20)(H2,16,17,18,21)
InChIKeyXBWFDZIDSWAQCE-UHFFFAOYSA-N
MW319.39 g/mol
LogP2.87
Rot. Bonds7

About 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid

4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 18322950) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid.

Molecular Properties

Compound Name4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid
PubChem CID18322950
Molecular FormulaC15H17N3O3S
Molecular Weight319.39 g/mol
Exact Mass319.10
IUPAC Name4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid
SMILESO=C(O)CCCc1csc(NC(=O)NCc2ccccc2)n1
InChIInChI=1S/C15H17N3O3S/c19-13(20)8-4-7-12-10-22-15(17-12)18-14(21)16-9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,19,20)(H2,16,17,18,21)
InChIKeyXBWFDZIDSWAQCE-UHFFFAOYSA-N
XLogP2.87
TPSA91.32 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500319.39
LogP ≤ 52.87
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid?
The IUPAC name of 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid (CID 18322950) is 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid.
What is the SMILES notation for 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid?
The canonical SMILES for 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid is O=C(O)CCCc1csc(NC(=O)NCc2ccccc2)n1.
What is the InChIKey of 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid?
The InChIKey is XBWFDZIDSWAQCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3S/c19-13(20)8-4-7-12-10-22-15(17-12)18-14(21)16-9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,19,20)(H2,16,17,18,21).
What are the key properties of 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid?
4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid has a molecular weight of 319.39 g/mol, XLogP of 2.87, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoic acid is sourced from PubChem (CID 18322950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).